C18H21ClFNO2 — CID 17291700
N-[[2-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]prop-2-en-1-amine;hydrochloride (PubChem CID 17291700) has the molecular formula C18H21ClFNO2 and a molecular weight of 337.82 g/mol. Its IUPAC name is N-[[2-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]prop-2-en-1-amine;hydrochloride.
| Compound Name | N-[[2-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]prop-2-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17291700 |
| Molecular Formula | C18H21ClFNO2 |
| Molecular Weight | 337.82 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | N-[[2-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]prop-2-en-1-amine;hydrochloride |
| SMILES | C=CCNCc1cccc(OC)c1OCc1ccccc1F.Cl |
| InChI | InChI=1S/C18H20FNO2.ClH/c1-3-11-20-12-14-8-6-10-17(21-2)18(14)22-13-15-7-4-5-9-16(15)19;/h3-10,20H,1,11-13H2,2H3;1H |
| InChIKey | LKACUVLBZKOKIP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.82 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|