C19H24FNO2 — CID 4721447
N-[[2-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-methylpropan-2-amine (PubChem CID 4721447) has the molecular formula C19H24FNO2 and a molecular weight of 317.40 g/mol. Its IUPAC name is N-[[2-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[2-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 4721447 |
| Molecular Formula | C19H24FNO2 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | N-[[2-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-methylpropan-2-amine |
| SMILES | COc1cccc(CNC(C)(C)C)c1OCc1ccccc1F |
| InChI | InChI=1S/C19H24FNO2/c1-19(2,3)21-12-14-9-7-11-17(22-4)18(14)23-13-15-8-5-6-10-16(15)20/h5-11,21H,12-13H2,1-4H3 |
| InChIKey | SFLQTPUMTYVCRX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |