C15H15FO3 — CID 2987070
[2-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methanol (PubChem CID 2987070) has the molecular formula C15H15FO3 and a molecular weight of 262.28 g/mol. Its IUPAC name is [2-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methanol.
| Compound Name | [2-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methanol |
|---|---|
| PubChem CID | 2987070 |
| Molecular Formula | C15H15FO3 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | [2-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methanol |
| SMILES | COc1cccc(CO)c1OCc1ccccc1F |
| InChI | InChI=1S/C15H15FO3/c1-18-14-8-4-6-11(9-17)15(14)19-10-12-5-2-3-7-13(12)16/h2-8,17H,9-10H2,1H3 |
| InChIKey | OTPMNAFCRSFUSS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |