C15H13BrF2O3 — CID 106264377
[2-[(3-bromo-2,6-difluorophenyl)methoxy]-3-methoxyphenyl]methanol (PubChem CID 106264377) has the molecular formula C15H13BrF2O3 and a molecular weight of 359.17 g/mol. Its IUPAC name is [2-[(3-bromo-2,6-difluorophenyl)methoxy]-3-methoxyphenyl]methanol.
| Compound Name | [2-[(3-bromo-2,6-difluorophenyl)methoxy]-3-methoxyphenyl]methanol |
|---|---|
| PubChem CID | 106264377 |
| Molecular Formula | C15H13BrF2O3 |
| Molecular Weight | 359.17 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | [2-[(3-bromo-2,6-difluorophenyl)methoxy]-3-methoxyphenyl]methanol |
| SMILES | COc1cccc(CO)c1OCc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C15H13BrF2O3/c1-20-13-4-2-3-9(7-19)15(13)21-8-10-12(17)6-5-11(16)14(10)18/h2-6,19H,7-8H2,1H3 |
| InChIKey | YQWVYSCDDNOCPJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.17 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|