C10H12F2O3 — CID 60922673
[2-(2,2-difluoroethoxy)-3-methoxyphenyl]methanol (PubChem CID 60922673) has the molecular formula C10H12F2O3 and a molecular weight of 218.20 g/mol. Its IUPAC name is [2-(2,2-difluoroethoxy)-3-methoxyphenyl]methanol.
| Compound Name | [2-(2,2-difluoroethoxy)-3-methoxyphenyl]methanol |
|---|---|
| PubChem CID | 60922673 |
| Molecular Formula | C10H12F2O3 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | [2-(2,2-difluoroethoxy)-3-methoxyphenyl]methanol |
| SMILES | COc1cccc(CO)c1OCC(F)F |
| InChI | InChI=1S/C10H12F2O3/c1-14-8-4-2-3-7(5-13)10(8)15-6-9(11)12/h2-4,9,13H,5-6H2,1H3 |
| InChIKey | MZIXHBAWKJTMTF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |