C13H14O3 — CID 117310761
(1,5-dimethoxynaphthalen-2-yl)methanol (PubChem CID 117310761) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is (1,5-dimethoxynaphthalen-2-yl)methanol.
| Compound Name | (1,5-dimethoxynaphthalen-2-yl)methanol |
|---|---|
| PubChem CID | 117310761 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (1,5-dimethoxynaphthalen-2-yl)methanol |
| SMILES | COc1cccc2c(OC)c(CO)ccc12 |
| InChI | InChI=1S/C13H14O3/c1-15-12-5-3-4-11-10(12)7-6-9(8-14)13(11)16-2/h3-7,14H,8H2,1-2H3 |
| InChIKey | CCIHOVGVXAMKPS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |