C9H13FO3 — CID 174818666
1,2,3-trimethoxybenzene;hydrofluoride (PubChem CID 174818666) has the molecular formula C9H13FO3 and a molecular weight of 188.20 g/mol. Its IUPAC name is 1,2,3-trimethoxybenzene;hydrofluoride.
| Compound Name | 1,2,3-trimethoxybenzene;hydrofluoride |
|---|---|
| PubChem CID | 174818666 |
| Molecular Formula | C9H13FO3 |
| Molecular Weight | 188.20 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 1,2,3-trimethoxybenzene;hydrofluoride |
| SMILES | COc1cccc(OC)c1OC.F |
| InChI | InChI=1S/C9H12O3.FH/c1-10-7-5-4-6-8(11-2)9(7)12-3;/h4-6H,1-3H3;1H |
| InChIKey | BQYNCPMCEHVRCX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.20 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |