C10H12O3 — CID 66367387
2-ethenoxy-1,3-dimethoxybenzene (PubChem CID 66367387) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is 2-ethenoxy-1,3-dimethoxybenzene.
| Compound Name | 2-ethenoxy-1,3-dimethoxybenzene |
|---|---|
| PubChem CID | 66367387 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 2-ethenoxy-1,3-dimethoxybenzene |
| SMILES | C=COc1c(OC)cccc1OC |
| InChI | InChI=1S/C10H12O3/c1-4-13-10-8(11-2)6-5-7-9(10)12-3/h4-7H,1H2,2-3H3 |
| InChIKey | XNCIJSTXEXOFHF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|