C11H15NO2 — CID 171218765
(1S)-1-(2,3-dimethoxyphenyl)prop-2-en-1-amine (PubChem CID 171218765) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is (1S)-1-(2,3-dimethoxyphenyl)prop-2-en-1-amine.
| Compound Name | (1S)-1-(2,3-dimethoxyphenyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 171218765 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (1S)-1-(2,3-dimethoxyphenyl)prop-2-en-1-amine |
| SMILES | C=C[C@H](N)c1cccc(OC)c1OC |
| InChI | InChI=1S/C11H15NO2/c1-4-9(12)8-6-5-7-10(13-2)11(8)14-3/h4-7,9H,1,12H2,2-3H3/t9-/m0/s1 |
| InChIKey | VHAINPQWIQMEQU-VIFPVBQESA-N |
| XLogP | 1.89 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|