C11H17NO3 — CID 28743907
(1R,2S)-2-amino-1-(2,3-dimethoxyphenyl)propan-1-ol (PubChem CID 28743907) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is (1R,2S)-2-amino-1-(2,3-dimethoxyphenyl)propan-1-ol.
| Compound Name | (1R,2S)-2-amino-1-(2,3-dimethoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 28743907 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | (1R,2S)-2-amino-1-(2,3-dimethoxyphenyl)propan-1-ol |
| SMILES | COc1cccc([C@@H](O)[C@H](C)N)c1OC |
| InChI | InChI=1S/C11H17NO3/c1-7(12)10(13)8-5-4-6-9(14-2)11(8)15-3/h4-7,10,13H,12H2,1-3H3/t7-,10-/m0/s1 |
| InChIKey | GWLPOWLUMAKGCV-XVKPBYJWSA-N |
| XLogP | 1.08 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |