C15H25NO3 — CID 171266758
(1S,2R)-1-amino-1-(2,3-dimethoxyphenyl)-5-methylhexan-2-ol (PubChem CID 171266758) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-(2,3-dimethoxyphenyl)-5-methylhexan-2-ol.
| Compound Name | (1S,2R)-1-amino-1-(2,3-dimethoxyphenyl)-5-methylhexan-2-ol |
|---|---|
| PubChem CID | 171266758 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | (1S,2R)-1-amino-1-(2,3-dimethoxyphenyl)-5-methylhexan-2-ol |
| SMILES | COc1cccc([C@H](N)[C@H](O)CCC(C)C)c1OC |
| InChI | InChI=1S/C15H25NO3/c1-10(2)8-9-12(17)14(16)11-6-5-7-13(18-3)15(11)19-4/h5-7,10,12,14,17H,8-9,16H2,1-4H3/t12-,14+/m1/s1 |
| InChIKey | PUCFABQGUXMZND-OCCSQVGLSA-N |
| XLogP | 2.50 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |