C11H18ClNO3 — CID 171162154
(1S,2R)-1-amino-1-(2,3-dimethoxyphenyl)propan-2-ol;hydrochloride (PubChem CID 171162154) has the molecular formula C11H18ClNO3 and a molecular weight of 247.72 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-(2,3-dimethoxyphenyl)propan-2-ol;hydrochloride.
| Compound Name | (1S,2R)-1-amino-1-(2,3-dimethoxyphenyl)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171162154 |
| Molecular Formula | C11H18ClNO3 |
| Molecular Weight | 247.72 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | (1S,2R)-1-amino-1-(2,3-dimethoxyphenyl)propan-2-ol;hydrochloride |
| SMILES | COc1cccc([C@H](N)[C@@H](C)O)c1OC.Cl |
| InChI | InChI=1S/C11H17NO3.ClH/c1-7(13)10(12)8-5-4-6-9(14-2)11(8)15-3;/h4-7,10,13H,12H2,1-3H3;1H/t7-,10-;/m1./s1 |
| InChIKey | PABYLMVFKJZXTF-YZUKSGEXSA-N |
| XLogP | 1.51 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.72 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |