C10H14FNO2 — CID 55271368
(1S,2S)-1-amino-1-(2-fluoro-3-methoxyphenyl)propan-2-ol (PubChem CID 55271368) has the molecular formula C10H14FNO2 and a molecular weight of 199.22 g/mol. Its IUPAC name is (1S,2S)-1-amino-1-(2-fluoro-3-methoxyphenyl)propan-2-ol.
| Compound Name | (1S,2S)-1-amino-1-(2-fluoro-3-methoxyphenyl)propan-2-ol |
|---|---|
| PubChem CID | 55271368 |
| Molecular Formula | C10H14FNO2 |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | (1S,2S)-1-amino-1-(2-fluoro-3-methoxyphenyl)propan-2-ol |
| SMILES | COc1cccc([C@H](N)[C@H](C)O)c1F |
| InChI | InChI=1S/C10H14FNO2/c1-6(13)10(12)7-4-3-5-8(14-2)9(7)11/h3-6,10,13H,12H2,1-2H3/t6-,10+/m0/s1 |
| InChIKey | BTILGAGIZREKDE-QUBYGPBYSA-N |
| XLogP | 1.21 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |