C9H9F3O2 — CID 112575477
2,2-difluoro-1-(2-fluoro-3-methoxyphenyl)ethanol (PubChem CID 112575477) has the molecular formula C9H9F3O2 and a molecular weight of 206.16 g/mol. Its IUPAC name is 2,2-difluoro-1-(2-fluoro-3-methoxyphenyl)ethanol.
| Compound Name | 2,2-difluoro-1-(2-fluoro-3-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 112575477 |
| Molecular Formula | C9H9F3O2 |
| Molecular Weight | 206.16 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 2,2-difluoro-1-(2-fluoro-3-methoxyphenyl)ethanol |
| SMILES | COc1cccc(C(O)C(F)F)c1F |
| InChI | InChI=1S/C9H9F3O2/c1-14-6-4-2-3-5(7(6)10)8(13)9(11)12/h2-4,8-9,13H,1H3 |
| InChIKey | NKMJDECAYGOPOL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.16 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |