C12H17FO3 — CID 103454923
1-(2-fluoro-3-methoxyphenyl)pentane-1,2-diol (PubChem CID 103454923) has the molecular formula C12H17FO3 and a molecular weight of 228.26 g/mol. Its IUPAC name is 1-(2-fluoro-3-methoxyphenyl)pentane-1,2-diol.
| Compound Name | 1-(2-fluoro-3-methoxyphenyl)pentane-1,2-diol |
|---|---|
| PubChem CID | 103454923 |
| Molecular Formula | C12H17FO3 |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 1-(2-fluoro-3-methoxyphenyl)pentane-1,2-diol |
| SMILES | CCCC(O)C(O)c1cccc(OC)c1F |
| InChI | InChI=1S/C12H17FO3/c1-3-5-9(14)12(15)8-6-4-7-10(16-2)11(8)13/h4,6-7,9,12,14-15H,3,5H2,1-2H3 |
| InChIKey | XOEHLNOWBYTIFB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |