C10H13FO4 — CID 170819054
1-(2-fluoro-3-methoxyphenyl)propane-1,2,3-triol (PubChem CID 170819054) has the molecular formula C10H13FO4 and a molecular weight of 216.21 g/mol. Its IUPAC name is 1-(2-fluoro-3-methoxyphenyl)propane-1,2,3-triol.
| Compound Name | 1-(2-fluoro-3-methoxyphenyl)propane-1,2,3-triol |
|---|---|
| PubChem CID | 170819054 |
| Molecular Formula | C10H13FO4 |
| Molecular Weight | 216.21 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 1-(2-fluoro-3-methoxyphenyl)propane-1,2,3-triol |
| SMILES | COc1cccc(C(O)C(O)CO)c1F |
| InChI | InChI=1S/C10H13FO4/c1-15-8-4-2-3-6(9(8)11)10(14)7(13)5-12/h2-4,7,10,12-14H,5H2,1H3 |
| InChIKey | KBIUJVKGNIKNHP-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.21 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |