C11H14F2O2 — CID 103454950
1-(2,3-difluorophenyl)pentane-1,2-diol (PubChem CID 103454950) has the molecular formula C11H14F2O2 and a molecular weight of 216.23 g/mol. Its IUPAC name is 1-(2,3-difluorophenyl)pentane-1,2-diol.
| Compound Name | 1-(2,3-difluorophenyl)pentane-1,2-diol |
|---|---|
| PubChem CID | 103454950 |
| Molecular Formula | C11H14F2O2 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 1-(2,3-difluorophenyl)pentane-1,2-diol |
| SMILES | CCCC(O)C(O)c1cccc(F)c1F |
| InChI | InChI=1S/C11H14F2O2/c1-2-4-9(14)11(15)7-5-3-6-8(12)10(7)13/h3,5-6,9,11,14-15H,2,4H2,1H3 |
| InChIKey | SJCMSZIJSRKYED-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |