C13H14F2 — CID 83925513
1,2-difluoro-3-hept-1-yn-4-ylbenzene (PubChem CID 83925513) has the molecular formula C13H14F2 and a molecular weight of 208.25 g/mol. Its IUPAC name is 1,2-difluoro-3-hept-1-yn-4-ylbenzene.
| Compound Name | 1,2-difluoro-3-hept-1-yn-4-ylbenzene |
|---|---|
| PubChem CID | 83925513 |
| Molecular Formula | C13H14F2 |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 1,2-difluoro-3-hept-1-yn-4-ylbenzene |
| SMILES | C#CCC(CCC)c1cccc(F)c1F |
| InChI | InChI=1S/C13H14F2/c1-3-6-10(7-4-2)11-8-5-9-12(14)13(11)15/h1,5,8-10H,4,6-7H2,2H3 |
| InChIKey | WXEFKKIRLCJTHG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|