C13H17BrF2 — CID 10989939
1-(1-bromoheptyl)-2,3-difluorobenzene (PubChem CID 10989939) has the molecular formula C13H17BrF2 and a molecular weight of 291.18 g/mol. Its IUPAC name is 1-(1-bromoheptyl)-2,3-difluorobenzene.
| Compound Name | 1-(1-bromoheptyl)-2,3-difluorobenzene |
|---|---|
| PubChem CID | 10989939 |
| Molecular Formula | C13H17BrF2 |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 1-(1-bromoheptyl)-2,3-difluorobenzene |
| SMILES | CCCCCCC(Br)c1cccc(F)c1F |
| InChI | InChI=1S/C13H17BrF2/c1-2-3-4-5-8-11(14)10-7-6-9-12(15)13(10)16/h6-7,9,11H,2-5,8H2,1H3 |
| InChIKey | IJXOGMPCRNOSGU-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|