C15H21BrF2 — CID 79731208
1-(1-bromooctyl)-2,4-difluoro-5-methylbenzene (PubChem CID 79731208) has the molecular formula C15H21BrF2 and a molecular weight of 319.23 g/mol. Its IUPAC name is 1-(1-bromooctyl)-2,4-difluoro-5-methylbenzene.
| Compound Name | 1-(1-bromooctyl)-2,4-difluoro-5-methylbenzene |
|---|---|
| PubChem CID | 79731208 |
| Molecular Formula | C15H21BrF2 |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 1-(1-bromooctyl)-2,4-difluoro-5-methylbenzene |
| SMILES | CCCCCCCC(Br)c1cc(C)c(F)cc1F |
| InChI | InChI=1S/C15H21BrF2/c1-3-4-5-6-7-8-13(16)12-9-11(2)14(17)10-15(12)18/h9-10,13H,3-8H2,1-2H3 |
| InChIKey | MNLNNPUCRHLVLB-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|