C18H29Br — CID 65428123
2-(1-bromononyl)-1,3,5-trimethylbenzene (PubChem CID 65428123) has the molecular formula C18H29Br and a molecular weight of 325.33 g/mol. Its IUPAC name is 2-(1-bromononyl)-1,3,5-trimethylbenzene.
| Compound Name | 2-(1-bromononyl)-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 65428123 |
| Molecular Formula | C18H29Br |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 2-(1-bromononyl)-1,3,5-trimethylbenzene |
| SMILES | CCCCCCCCC(Br)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C18H29Br/c1-5-6-7-8-9-10-11-17(19)18-15(3)12-14(2)13-16(18)4/h12-13,17H,5-11H2,1-4H3 |
| InChIKey | SKOHSUYRCSGCBT-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|