C17H27BrO3 — CID 63438336
2-(1-bromooctyl)-1,3,5-trimethoxybenzene (PubChem CID 63438336) has the molecular formula C17H27BrO3 and a molecular weight of 359.30 g/mol. Its IUPAC name is 2-(1-bromooctyl)-1,3,5-trimethoxybenzene.
| Compound Name | 2-(1-bromooctyl)-1,3,5-trimethoxybenzene |
|---|---|
| PubChem CID | 63438336 |
| Molecular Formula | C17H27BrO3 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 2-(1-bromooctyl)-1,3,5-trimethoxybenzene |
| SMILES | CCCCCCCC(Br)c1c(OC)cc(OC)cc1OC |
| InChI | InChI=1S/C17H27BrO3/c1-5-6-7-8-9-10-14(18)17-15(20-3)11-13(19-2)12-16(17)21-4/h11-12,14H,5-10H2,1-4H3 |
| InChIKey | PXSZSYLKLXLFGB-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|