C15H24O4 — CID 54146903
2-hexoxy-1,3,5-trimethoxybenzene (PubChem CID 54146903) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is 2-hexoxy-1,3,5-trimethoxybenzene.
| Compound Name | 2-hexoxy-1,3,5-trimethoxybenzene |
|---|---|
| PubChem CID | 54146903 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 2-hexoxy-1,3,5-trimethoxybenzene |
| SMILES | CCCCCCOc1c(OC)cc(OC)cc1OC |
| InChI | InChI=1S/C15H24O4/c1-5-6-7-8-9-19-15-13(17-3)10-12(16-2)11-14(15)18-4/h10-11H,5-9H2,1-4H3 |
| InChIKey | LOOFUEHYUUBOOO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|