C21H32O5 — CID 85358629
3-(4-decoxy-3,5-dimethoxyphenyl)prop-2-enoic acid (PubChem CID 85358629) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is 3-(4-decoxy-3,5-dimethoxyphenyl)prop-2-enoic acid.
| Compound Name | 3-(4-decoxy-3,5-dimethoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 85358629 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 3-(4-decoxy-3,5-dimethoxyphenyl)prop-2-enoic acid |
| SMILES | CCCCCCCCCCOc1c(OC)cc(C=CC(=O)O)cc1OC |
| InChI | InChI=1S/C21H32O5/c1-4-5-6-7-8-9-10-11-14-26-21-18(24-2)15-17(12-13-20(22)23)16-19(21)25-3/h12-13,15-16H,4-11,14H2,1-3H3,(H,22,23) |
| InChIKey | WTDLAVUWPOPUOI-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|