C14H17NO6 — CID 43516859
(E)-3-[4-(3-amino-3-oxopropoxy)-3,5-dimethoxyphenyl]prop-2-enoic acid (PubChem CID 43516859) has the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. Its IUPAC name is (E)-3-[4-(3-amino-3-oxopropoxy)-3,5-dimethoxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(3-amino-3-oxopropoxy)-3,5-dimethoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 43516859 |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | (E)-3-[4-(3-amino-3-oxopropoxy)-3,5-dimethoxyphenyl]prop-2-enoic acid |
| SMILES | COc1cc(/C=C/C(=O)O)cc(OC)c1OCCC(N)=O |
| InChI | InChI=1S/C14H17NO6/c1-19-10-7-9(3-4-13(17)18)8-11(20-2)14(10)21-6-5-12(15)16/h3-4,7-8H,5-6H2,1-2H3,(H2,15,16)(H,17,18)/b4-3+ |
| InChIKey | XUGQFVQZLDJNRH-ONEGZZNKSA-N |
| XLogP | 1.06 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|