C12H11F2NO4 — CID 79887511
3-[4-(3-amino-3-oxopropoxy)-3,5-difluorophenyl]prop-2-enoic acid (PubChem CID 79887511) has the molecular formula C12H11F2NO4 and a molecular weight of 271.22 g/mol. Its IUPAC name is 3-[4-(3-amino-3-oxopropoxy)-3,5-difluorophenyl]prop-2-enoic acid.
| Compound Name | 3-[4-(3-amino-3-oxopropoxy)-3,5-difluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 79887511 |
| Molecular Formula | C12H11F2NO4 |
| Molecular Weight | 271.22 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 3-[4-(3-amino-3-oxopropoxy)-3,5-difluorophenyl]prop-2-enoic acid |
| SMILES | NC(=O)CCOc1c(F)cc(C=CC(=O)O)cc1F |
| InChI | InChI=1S/C12H11F2NO4/c13-8-5-7(1-2-11(17)18)6-9(14)12(8)19-4-3-10(15)16/h1-2,5-6H,3-4H2,(H2,15,16)(H,17,18) |
| InChIKey | PYTINJFGMFUHML-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.22 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|