C15H16F2O4 — CID 79881568
3-[3,5-difluoro-4-(oxan-4-ylmethoxy)phenyl]prop-2-enoic acid (PubChem CID 79881568) has the molecular formula C15H16F2O4 and a molecular weight of 298.28 g/mol. Its IUPAC name is 3-[3,5-difluoro-4-(oxan-4-ylmethoxy)phenyl]prop-2-enoic acid.
| Compound Name | 3-[3,5-difluoro-4-(oxan-4-ylmethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 79881568 |
| Molecular Formula | C15H16F2O4 |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 3-[3,5-difluoro-4-(oxan-4-ylmethoxy)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cc(F)c(OCC2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C15H16F2O4/c16-12-7-11(1-2-14(18)19)8-13(17)15(12)21-9-10-3-5-20-6-4-10/h1-2,7-8,10H,3-6,9H2,(H,18,19) |
| InChIKey | RTSGTCHNKJJPCZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|