C14H15FO4 — CID 112614259
(E)-3-[3-fluoro-2-(oxolan-3-ylmethoxy)phenyl]prop-2-enoic acid (PubChem CID 112614259) has the molecular formula C14H15FO4 and a molecular weight of 266.27 g/mol. Its IUPAC name is (E)-3-[3-fluoro-2-(oxolan-3-ylmethoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-fluoro-2-(oxolan-3-ylmethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 112614259 |
| Molecular Formula | C14H15FO4 |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | (E)-3-[3-fluoro-2-(oxolan-3-ylmethoxy)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cccc(F)c1OCC1CCOC1 |
| InChI | InChI=1S/C14H15FO4/c15-12-3-1-2-11(4-5-13(16)17)14(12)19-9-10-6-7-18-8-10/h1-5,10H,6-9H2,(H,16,17)/b5-4+ |
| InChIKey | YLABXTOAPHXHST-SNAWJCMRSA-N |
| XLogP | 2.34 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|