C14H15BrO4 — CID 76983070
3-[3-bromo-4-(oxolan-3-ylmethoxy)phenyl]prop-2-enoic acid (PubChem CID 76983070) has the molecular formula C14H15BrO4 and a molecular weight of 327.17 g/mol. Its IUPAC name is 3-[3-bromo-4-(oxolan-3-ylmethoxy)phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-bromo-4-(oxolan-3-ylmethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76983070 |
| Molecular Formula | C14H15BrO4 |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 3-[3-bromo-4-(oxolan-3-ylmethoxy)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(OCC2CCOC2)c(Br)c1 |
| InChI | InChI=1S/C14H15BrO4/c15-12-7-10(2-4-14(16)17)1-3-13(12)19-9-11-5-6-18-8-11/h1-4,7,11H,5-6,8-9H2,(H,16,17) |
| InChIKey | HZTRJCLHTWKQDY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|