C17H19BrO3 — CID 79563441
3-[4-(2-bicyclo[2.2.1]heptanylmethoxy)-3-bromophenyl]prop-2-enoic acid (PubChem CID 79563441) has the molecular formula C17H19BrO3 and a molecular weight of 351.24 g/mol. Its IUPAC name is 3-[4-(2-bicyclo[2.2.1]heptanylmethoxy)-3-bromophenyl]prop-2-enoic acid.
| Compound Name | 3-[4-(2-bicyclo[2.2.1]heptanylmethoxy)-3-bromophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 79563441 |
| Molecular Formula | C17H19BrO3 |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 3-[4-(2-bicyclo[2.2.1]heptanylmethoxy)-3-bromophenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(OCC2CC3CCC2C3)c(Br)c1 |
| InChI | InChI=1S/C17H19BrO3/c18-15-9-11(3-6-17(19)20)2-5-16(15)21-10-14-8-12-1-4-13(14)7-12/h2-3,5-6,9,12-14H,1,4,7-8,10H2,(H,19,20) |
| InChIKey | SJROYHXCAMQXDB-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|