C15H17BrO4 — CID 76983063
3-[3-bromo-4-(oxan-4-ylmethoxy)phenyl]prop-2-enoic acid (PubChem CID 76983063) has the molecular formula C15H17BrO4 and a molecular weight of 341.20 g/mol. Its IUPAC name is 3-[3-bromo-4-(oxan-4-ylmethoxy)phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-bromo-4-(oxan-4-ylmethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76983063 |
| Molecular Formula | C15H17BrO4 |
| Molecular Weight | 341.20 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 3-[3-bromo-4-(oxan-4-ylmethoxy)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(OCC2CCOCC2)c(Br)c1 |
| InChI | InChI=1S/C15H17BrO4/c16-13-9-11(2-4-15(17)18)1-3-14(13)20-10-12-5-7-19-8-6-12/h1-4,9,12H,5-8,10H2,(H,17,18) |
| InChIKey | XNWXIAFXZHEWID-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.20 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|