C18H21F2NO6 — CID 168568632
dimethyl (E)-2-[3,5-difluoro-4-(oxan-4-ylmethoxy)anilino]but-2-enedioate (PubChem CID 168568632) has the molecular formula C18H21F2NO6 and a molecular weight of 385.36 g/mol. Its IUPAC name is dimethyl (E)-2-[3,5-difluoro-4-(oxan-4-ylmethoxy)anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[3,5-difluoro-4-(oxan-4-ylmethoxy)anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168568632 |
| Molecular Formula | C18H21F2NO6 |
| Molecular Weight | 385.36 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | dimethyl (E)-2-[3,5-difluoro-4-(oxan-4-ylmethoxy)anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1cc(F)c(OCC2CCOCC2)c(F)c1)C(=O)OC |
| InChI | InChI=1S/C18H21F2NO6/c1-24-16(22)9-15(18(23)25-2)21-12-7-13(19)17(14(20)8-12)27-10-11-3-5-26-6-4-11/h7-9,11,21H,3-6,10H2,1-2H3/b15-9+ |
| InChIKey | PTIOTIDZWPEBCK-OQLLNIDSSA-N |
| XLogP | 2.41 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|