C11H11F2NO3 — CID 539751
N-[3,5-difluoro-4-(oxiran-2-ylmethoxy)phenyl]acetamide (PubChem CID 539751) has the molecular formula C11H11F2NO3 and a molecular weight of 243.21 g/mol. Its IUPAC name is N-[3,5-difluoro-4-(oxiran-2-ylmethoxy)phenyl]acetamide.
| Compound Name | N-[3,5-difluoro-4-(oxiran-2-ylmethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 539751 |
| Molecular Formula | C11H11F2NO3 |
| Molecular Weight | 243.21 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | N-[3,5-difluoro-4-(oxiran-2-ylmethoxy)phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(F)c(OCC2CO2)c(F)c1 |
| InChI | InChI=1S/C11H11F2NO3/c1-6(15)14-7-2-9(12)11(10(13)3-7)17-5-8-4-16-8/h2-3,8H,4-5H2,1H3,(H,14,15) |
| InChIKey | MWFJMSZSZPYNCB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.21 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|