C28H38O4 — CID 87442207
2-[[4-[2-[3,5-diethyl-4-(oxiran-2-ylmethoxy)phenyl]ethyl]-2,6-diethylphenoxy]methyl]oxirane (PubChem CID 87442207) has the molecular formula C28H38O4 and a molecular weight of 438.61 g/mol. Its IUPAC name is 2-[[4-[2-[3,5-diethyl-4-(oxiran-2-ylmethoxy)phenyl]ethyl]-2,6-diethylphenoxy]methyl]oxirane.
| Compound Name | 2-[[4-[2-[3,5-diethyl-4-(oxiran-2-ylmethoxy)phenyl]ethyl]-2,6-diethylphenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 87442207 |
| Molecular Formula | C28H38O4 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | 2-[[4-[2-[3,5-diethyl-4-(oxiran-2-ylmethoxy)phenyl]ethyl]-2,6-diethylphenoxy]methyl]oxirane |
| SMILES | CCc1cc(CCc2cc(CC)c(OCC3CO3)c(CC)c2)cc(CC)c1OCC1CO1 |
| InChI | InChI=1S/C28H38O4/c1-5-21-11-19(12-22(6-2)27(21)31-17-25-15-29-25)9-10-20-13-23(7-3)28(24(8-4)14-20)32-18-26-16-30-26/h11-14,25-26H,5-10,15-18H2,1-4H3 |
| InChIKey | LKZOCKJZRPBPIU-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|