C12H10Br4O4 — CID 57190292
2-[[2,3,5,6-tetrabromo-4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane (PubChem CID 57190292) has the molecular formula C12H10Br4O4 and a molecular weight of 537.82 g/mol. Its IUPAC name is 2-[[2,3,5,6-tetrabromo-4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane.
| Compound Name | 2-[[2,3,5,6-tetrabromo-4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 57190292 |
| Molecular Formula | C12H10Br4O4 |
| Molecular Weight | 537.82 g/mol |
| Exact Mass | 533.73 |
| IUPAC Name | 2-[[2,3,5,6-tetrabromo-4-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane |
| SMILES | Brc1c(Br)c(OCC2CO2)c(Br)c(Br)c1OCC1CO1 |
| InChI | InChI=1S/C12H10Br4O4/c13-7-9(15)12(20-4-6-2-18-6)10(16)8(14)11(7)19-3-5-1-17-5/h5-6H,1-4H2 |
| InChIKey | YFQKUHQEOPYDKR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.82 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|