C11H13ClO2 — CID 43175697
2-[(4-chloro-3,5-dimethylphenoxy)methyl]oxirane (PubChem CID 43175697) has the molecular formula C11H13ClO2 and a molecular weight of 212.68 g/mol. Its IUPAC name is 2-[(4-chloro-3,5-dimethylphenoxy)methyl]oxirane.
| Compound Name | 2-[(4-chloro-3,5-dimethylphenoxy)methyl]oxirane |
|---|---|
| PubChem CID | 43175697 |
| Molecular Formula | C11H13ClO2 |
| Molecular Weight | 212.68 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 2-[(4-chloro-3,5-dimethylphenoxy)methyl]oxirane |
| SMILES | Cc1cc(OCC2CO2)cc(C)c1Cl |
| InChI | InChI=1S/C11H13ClO2/c1-7-3-9(4-8(2)11(7)12)13-5-10-6-14-10/h3-4,10H,5-6H2,1-2H3 |
| InChIKey | RWRGVPRFWNMIRF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.68 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|