C10H10Br2O2 — CID 101298514
2-[(3,4-dibromo-5-methylphenoxy)methyl]oxirane (PubChem CID 101298514) has the molecular formula C10H10Br2O2 and a molecular weight of 322.00 g/mol. Its IUPAC name is 2-[(3,4-dibromo-5-methylphenoxy)methyl]oxirane.
| Compound Name | 2-[(3,4-dibromo-5-methylphenoxy)methyl]oxirane |
|---|---|
| PubChem CID | 101298514 |
| Molecular Formula | C10H10Br2O2 |
| Molecular Weight | 322.00 g/mol |
| Exact Mass | 319.90 |
| IUPAC Name | 2-[(3,4-dibromo-5-methylphenoxy)methyl]oxirane |
| SMILES | Cc1cc(OCC2CO2)cc(Br)c1Br |
| InChI | InChI=1S/C10H10Br2O2/c1-6-2-7(3-9(11)10(6)12)13-4-8-5-14-8/h2-3,8H,4-5H2,1H3 |
| InChIKey | MBLKNPBVKSCSBH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.00 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|