C70H80O24 — CID 87570733
2-[[3,5-bis(oxiran-2-ylmethoxy)-2-[3,5,7-tris[2,4,6-tris(oxiran-2-ylmethoxy)phenyl]-1-adamantyl]phenoxy]methyl]oxirane (PubChem CID 87570733) has the molecular formula C70H80O24 and a molecular weight of 1305.39 g/mol. Its IUPAC name is 2-[[3,5-bis(oxiran-2-ylmethoxy)-2-[3,5,7-tris[2,4,6-tris(oxiran-2-ylmethoxy)phenyl]-1-adamantyl]phenoxy]methyl]oxirane.
| Compound Name | 2-[[3,5-bis(oxiran-2-ylmethoxy)-2-[3,5,7-tris[2,4,6-tris(oxiran-2-ylmethoxy)phenyl]-1-adamantyl]phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 87570733 |
| Molecular Formula | C70H80O24 |
| Molecular Weight | 1305.39 g/mol |
| Exact Mass | 1304.50 |
| IUPAC Name | 2-[[3,5-bis(oxiran-2-ylmethoxy)-2-[3,5,7-tris[2,4,6-tris(oxiran-2-ylmethoxy)phenyl]-1-adamantyl]phenoxy]methyl]oxirane |
| SMILES | c1c(OCC2CO2)cc(OCC2CO2)c(C23CC4(c5c(OCC6CO6)cc(OCC6CO6)cc5OCC5CO5)CC(c5c(OCC6CO6)cc(OCC6CO6)cc5OCC5CO5)(C2)CC(c2c(OCC5CO5)cc(OCC5CO5)cc2OCC2CO2)(C3)C4)c1OCC1CO1 |
| InChI | InChI=1S/C70H80O24/c1-39(71-9-43-13-75-43)2-56(88-26-48-18-80-48)63(55(1)87-25-47-17-79-47)67-33-68(64-57(89-27-49-19-81-49)3-40(72-10-44-14-76-44)4-58(64)90-28-50-20-82-50)36-69(34-67,65-59(91-29-51-21-83-51)5-41(73-11-45-15-77-45)6-60(65)92-30-52-22-84-52)38-70(35-67,37-68)66-61(93-31-53-23-85-53)7-42(74-12-46-16-78-46)8-62(66)94-32-54-24-86-54/h1-8,43-54H,9-38H2 |
| InChIKey | LVIKLRMYDFGZFA-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 261.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 94 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1305.39 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|