C31H42O2 — CID 87124958
2-[[2,3-bis(1-adamantyl)-4,5-dimethylphenoxy]methyl]oxirane (PubChem CID 87124958) has the molecular formula C31H42O2 and a molecular weight of 446.68 g/mol. Its IUPAC name is 2-[[2,3-bis(1-adamantyl)-4,5-dimethylphenoxy]methyl]oxirane.
| Compound Name | 2-[[2,3-bis(1-adamantyl)-4,5-dimethylphenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 87124958 |
| Molecular Formula | C31H42O2 |
| Molecular Weight | 446.68 g/mol |
| Exact Mass | 446.32 |
| IUPAC Name | 2-[[2,3-bis(1-adamantyl)-4,5-dimethylphenoxy]methyl]oxirane |
| SMILES | Cc1cc(OCC2CO2)c(C23CC4CC(CC(C4)C2)C3)c(C23CC4CC(CC(C4)C2)C3)c1C |
| InChI | InChI=1S/C31H42O2/c1-18-3-27(33-17-26-16-32-26)29(31-13-23-7-24(14-31)9-25(8-23)15-31)28(19(18)2)30-10-20-4-21(11-30)6-22(5-20)12-30/h3,20-26H,4-17H2,1-2H3 |
| InChIKey | ICCXKMSZNZEHIX-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.68 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|