C43H58O4 — CID 87124678
2-[[2,3,4-tris(1-adamantyl)-6-methyl-5-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane (PubChem CID 87124678) has the molecular formula C43H58O4 and a molecular weight of 638.93 g/mol. Its IUPAC name is 2-[[2,3,4-tris(1-adamantyl)-6-methyl-5-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane.
| Compound Name | 2-[[2,3,4-tris(1-adamantyl)-6-methyl-5-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 87124678 |
| Molecular Formula | C43H58O4 |
| Molecular Weight | 638.93 g/mol |
| Exact Mass | 638.43 |
| IUPAC Name | 2-[[2,3,4-tris(1-adamantyl)-6-methyl-5-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane |
| SMILES | Cc1c(OCC2CO2)c(C23CC4CC(CC(C4)C2)C3)c(C23CC4CC(CC(C4)C2)C3)c(C23CC4CC(CC(C4)C2)C3)c1OCC1CO1 |
| InChI | InChI=1S/C43H58O4/c1-24-39(46-22-34-20-44-34)37(42-14-28-5-29(15-42)7-30(6-28)16-42)36(41-11-25-2-26(12-41)4-27(3-25)13-41)38(40(24)47-23-35-21-45-35)43-17-31-8-32(18-43)10-33(9-31)19-43/h25-35H,2-23H2,1H3 |
| InChIKey | NAWCPAUUFFBJSL-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.93 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|