C39H52O5 — CID 87124661
2-[[2,4,6-tris(1-adamantyloxy)phenoxy]methyl]oxirane (PubChem CID 87124661) has the molecular formula C39H52O5 and a molecular weight of 600.84 g/mol. Its IUPAC name is 2-[[2,4,6-tris(1-adamantyloxy)phenoxy]methyl]oxirane.
| Compound Name | 2-[[2,4,6-tris(1-adamantyloxy)phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 87124661 |
| Molecular Formula | C39H52O5 |
| Molecular Weight | 600.84 g/mol |
| Exact Mass | 600.38 |
| IUPAC Name | 2-[[2,4,6-tris(1-adamantyloxy)phenoxy]methyl]oxirane |
| SMILES | c1c(OC23CC4CC(CC(C4)C2)C3)cc(OC23CC4CC(CC(C4)C2)C3)c(OCC2CO2)c1OC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C39H52O5/c1-23-2-25-3-24(1)13-37(12-23,14-25)42-32-10-34(43-38-15-26-4-27(16-38)6-28(5-26)17-38)36(41-22-33-21-40-33)35(11-32)44-39-18-29-7-30(19-39)9-31(8-29)20-39/h10-11,23-31,33H,1-9,12-22H2 |
| InChIKey | YKUIFLXYBOWFRB-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.84 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|