About 2-[[2,4,6-tris(1-adamantyloxy)phenoxy]methyl]oxirane
2-[[2,4,6-tris(1-adamantyloxy)phenoxy]methyl]oxirane (PubChem CID 87124661) has the molecular formula C39H52O5
and a molecular weight of 600.84 g/mol. Its IUPAC name is 2-[[2,4,6-tris(1-adamantyloxy)phenoxy]methyl]oxirane.
Molecular Properties
| Compound Name | 2-[[2,4,6-tris(1-adamantyloxy)phenoxy]methyl]oxirane |
| PubChem CID | 87124661 |
| Molecular Formula | C39H52O5 |
| Molecular Weight | 600.84 g/mol |
| Exact Mass | 600.38 |
| IUPAC Name | 2-[[2,4,6-tris(1-adamantyloxy)phenoxy]methyl]oxirane |
| SMILES | c1c(OC23CC4CC(CC(C4)C2)C3)cc(OC23CC4CC(CC(C4)C2)C3)c(OCC2CO2)c1OC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C39H52O5/c1-23-2-25-3-24(1)13-37(12-23,14-25)42-32-10-34(43-38-15-26-4-27(16-38)6-28(5-26)17-38)36(41-22-33-21-40-33)35(11-32)44-39-18-29-7-30(19-39)9-31(8-29)20-39/h10-11,23-31,33H,1-9,12-22H2 |
| InChIKey | YKUIFLXYBOWFRB-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 600.84 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2,4,6-tris(1-adamantyloxy)phenoxy]methyl]oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2,4,6-tris(1-adamantyloxy)phenoxy]methyl]oxirane?
The IUPAC name of 2-[[2,4,6-tris(1-adamantyloxy)phenoxy]methyl]oxirane (CID 87124661) is 2-[[2,4,6-tris(1-adamantyloxy)phenoxy]methyl]oxirane.
What is the SMILES notation for 2-[[2,4,6-tris(1-adamantyloxy)phenoxy]methyl]oxirane?
The canonical SMILES for 2-[[2,4,6-tris(1-adamantyloxy)phenoxy]methyl]oxirane is c1c(OC23CC4CC(CC(C4)C2)C3)cc(OC23CC4CC(CC(C4)C2)C3)c(OCC2CO2)c1OC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 2-[[2,4,6-tris(1-adamantyloxy)phenoxy]methyl]oxirane?
The InChIKey is YKUIFLXYBOWFRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C39H52O5/c1-23-2-25-3-24(1)13-37(12-23,14-25)42-32-10-34(43-38-15-26-4-27(16-38)6-28(5-26)17-38)36(41-22-33-21-40-33)35(11-32)44-39-18-29-7-30(19-39)9-31(8-29)20-39/h10-11,23-31,33H,1-9,12-22H2.
What are the key properties of 2-[[2,4,6-tris(1-adamantyloxy)phenoxy]methyl]oxirane?
2-[[2,4,6-tris(1-adamantyloxy)phenoxy]methyl]oxirane has a molecular weight of 600.84 g/mol, XLogP of 8.51, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2,4,6-tris(1-adamantyloxy)phenoxy]methyl]oxirane is sourced from PubChem (CID 87124661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).