C40H48O12 — CID 87570956
2-[[2,5-bis(oxiran-2-ylmethoxy)-4-[2-[2,4,5-tris(oxiran-2-ylmethoxy)phenyl]-2-adamantyl]phenoxy]methyl]oxirane (PubChem CID 87570956) has the molecular formula C40H48O12 and a molecular weight of 720.81 g/mol. Its IUPAC name is 2-[[2,5-bis(oxiran-2-ylmethoxy)-4-[2-[2,4,5-tris(oxiran-2-ylmethoxy)phenyl]-2-adamantyl]phenoxy]methyl]oxirane.
| Compound Name | 2-[[2,5-bis(oxiran-2-ylmethoxy)-4-[2-[2,4,5-tris(oxiran-2-ylmethoxy)phenyl]-2-adamantyl]phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 87570956 |
| Molecular Formula | C40H48O12 |
| Molecular Weight | 720.81 g/mol |
| Exact Mass | 720.31 |
| IUPAC Name | 2-[[2,5-bis(oxiran-2-ylmethoxy)-4-[2-[2,4,5-tris(oxiran-2-ylmethoxy)phenyl]-2-adamantyl]phenoxy]methyl]oxirane |
| SMILES | c1c(OCC2CO2)c(OCC2CO2)cc(C2(c3cc(OCC4CO4)c(OCC4CO4)cc3OCC3CO3)C3CC4CC(C3)CC2C4)c1OCC1CO1 |
| InChI | InChI=1S/C40H48O12/c1-22-2-24-4-23(1)5-25(3-22)40(24,32-6-36(49-18-28-12-43-28)38(51-20-30-14-45-30)8-34(32)47-16-26-10-41-26)33-7-37(50-19-29-13-44-29)39(52-21-31-15-46-31)9-35(33)48-17-27-11-42-27/h6-9,22-31H,1-5,10-21H2 |
| InChIKey | QMIZMWIHBRMCHL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 130.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.81 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|