C10H10Cl2O3 — CID 58044663
2-[(4,5-dichloro-2-methoxyphenoxy)methyl]oxirane (PubChem CID 58044663) has the molecular formula C10H10Cl2O3 and a molecular weight of 249.09 g/mol. Its IUPAC name is 2-[(4,5-dichloro-2-methoxyphenoxy)methyl]oxirane.
| Compound Name | 2-[(4,5-dichloro-2-methoxyphenoxy)methyl]oxirane |
|---|---|
| PubChem CID | 58044663 |
| Molecular Formula | C10H10Cl2O3 |
| Molecular Weight | 249.09 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | 2-[(4,5-dichloro-2-methoxyphenoxy)methyl]oxirane |
| SMILES | COc1cc(Cl)c(Cl)cc1OCC1CO1 |
| InChI | InChI=1S/C10H10Cl2O3/c1-13-9-2-7(11)8(12)3-10(9)15-5-6-4-14-6/h2-3,6H,4-5H2,1H3 |
| InChIKey | GKAJUYNXBRLXRT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.09 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|