C19H20Cl2O3 — CID 163950191
2-[[2-chloro-4-[2-(3-chloro-4-methoxyphenyl)propan-2-yl]phenoxy]methyl]oxirane (PubChem CID 163950191) has the molecular formula C19H20Cl2O3 and a molecular weight of 367.27 g/mol. Its IUPAC name is 2-[[2-chloro-4-[2-(3-chloro-4-methoxyphenyl)propan-2-yl]phenoxy]methyl]oxirane.
| Compound Name | 2-[[2-chloro-4-[2-(3-chloro-4-methoxyphenyl)propan-2-yl]phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 163950191 |
| Molecular Formula | C19H20Cl2O3 |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 2-[[2-chloro-4-[2-(3-chloro-4-methoxyphenyl)propan-2-yl]phenoxy]methyl]oxirane |
| SMILES | COc1ccc(C(C)(C)c2ccc(OCC3CO3)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C19H20Cl2O3/c1-19(2,12-4-6-17(22-3)15(20)8-12)13-5-7-18(16(21)9-13)24-11-14-10-23-14/h4-9,14H,10-11H2,1-3H3 |
| InChIKey | RYQLQUWRSQYHFB-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|