C27H32O4 — CID 130314268
2-[4-[2-[4-(oxiran-2-ylmethoxy)-3-prop-2-enylphenyl]propan-2-yl]-2-prop-2-enylphenoxy]oxetane (PubChem CID 130314268) has the molecular formula C27H32O4 and a molecular weight of 420.55 g/mol. Its IUPAC name is 2-[4-[2-[4-(oxiran-2-ylmethoxy)-3-prop-2-enylphenyl]propan-2-yl]-2-prop-2-enylphenoxy]oxetane.
| Compound Name | 2-[4-[2-[4-(oxiran-2-ylmethoxy)-3-prop-2-enylphenyl]propan-2-yl]-2-prop-2-enylphenoxy]oxetane |
|---|---|
| PubChem CID | 130314268 |
| Molecular Formula | C27H32O4 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 2-[4-[2-[4-(oxiran-2-ylmethoxy)-3-prop-2-enylphenyl]propan-2-yl]-2-prop-2-enylphenoxy]oxetane |
| SMILES | C=CCc1cc(C(C)(C)c2ccc(OC3CCO3)c(CC=C)c2)ccc1OCC1CO1 |
| InChI | InChI=1S/C27H32O4/c1-5-7-19-15-21(9-11-24(19)30-18-23-17-29-23)27(3,4)22-10-12-25(20(16-22)8-6-2)31-26-13-14-28-26/h5-6,9-12,15-16,23,26H,1-2,7-8,13-14,17-18H2,3-4H3 |
| InChIKey | WHMYYHVBOVMVSW-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|