C27H36O4 — CID 146258358
2-[(3E,5E)-4-[2-[4-(oxiran-2-ylmethoxy)-3-prop-2-enylphenyl]propan-2-yl]nona-3,5,8-trienoxy]oxetane (PubChem CID 146258358) has the molecular formula C27H36O4 and a molecular weight of 424.58 g/mol. Its IUPAC name is 2-[(3E,5E)-4-[2-[4-(oxiran-2-ylmethoxy)-3-prop-2-enylphenyl]propan-2-yl]nona-3,5,8-trienoxy]oxetane.
| Compound Name | 2-[(3E,5E)-4-[2-[4-(oxiran-2-ylmethoxy)-3-prop-2-enylphenyl]propan-2-yl]nona-3,5,8-trienoxy]oxetane |
|---|---|
| PubChem CID | 146258358 |
| Molecular Formula | C27H36O4 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 2-[(3E,5E)-4-[2-[4-(oxiran-2-ylmethoxy)-3-prop-2-enylphenyl]propan-2-yl]nona-3,5,8-trienoxy]oxetane |
| SMILES | C=CC/C=C/C(=C\CCOC1CCO1)C(C)(C)c1ccc(OCC2CO2)c(CC=C)c1 |
| InChI | InChI=1S/C27H36O4/c1-5-7-8-11-22(12-9-16-28-26-15-17-29-26)27(3,4)23-13-14-25(21(18-23)10-6-2)31-20-24-19-30-24/h5-6,8,11-14,18,24,26H,1-2,7,9-10,15-17,19-20H2,3-4H3/b11-8+,22-12+ |
| InChIKey | NLZBHUVIUOSQFS-VNNYSTBCSA-N |
| XLogP | 5.68 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|