C25H28O4 — CID 90233959
2-[[6-(oxiran-2-ylmethoxy)-1,3,5-tris(prop-2-enyl)naphthalen-2-yl]oxymethyl]oxirane (PubChem CID 90233959) has the molecular formula C25H28O4 and a molecular weight of 392.50 g/mol. Its IUPAC name is 2-[[6-(oxiran-2-ylmethoxy)-1,3,5-tris(prop-2-enyl)naphthalen-2-yl]oxymethyl]oxirane.
| Compound Name | 2-[[6-(oxiran-2-ylmethoxy)-1,3,5-tris(prop-2-enyl)naphthalen-2-yl]oxymethyl]oxirane |
|---|---|
| PubChem CID | 90233959 |
| Molecular Formula | C25H28O4 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 2-[[6-(oxiran-2-ylmethoxy)-1,3,5-tris(prop-2-enyl)naphthalen-2-yl]oxymethyl]oxirane |
| SMILES | C=CCc1cc2c(CC=C)c(OCC3CO3)ccc2c(CC=C)c1OCC1CO1 |
| InChI | InChI=1S/C25H28O4/c1-4-7-17-12-23-20(22(9-6-3)25(17)29-16-19-14-27-19)10-11-24(21(23)8-5-2)28-15-18-13-26-18/h4-6,10-12,18-19H,1-3,7-9,13-16H2 |
| InChIKey | IPBRHUWFDLGNDW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|