C47H52O6 — CID 130209636
2-[[4-[2-[4-[1,1-bis[4-(oxiran-2-ylmethoxy)-3-prop-2-enylphenyl]ethyl]phenyl]propan-2-yl]-2-prop-2-enylphenoxy]methyl]oxirane (PubChem CID 130209636) has the molecular formula C47H52O6 and a molecular weight of 712.93 g/mol. Its IUPAC name is 2-[[4-[2-[4-[1,1-bis[4-(oxiran-2-ylmethoxy)-3-prop-2-enylphenyl]ethyl]phenyl]propan-2-yl]-2-prop-2-enylphenoxy]methyl]oxirane.
| Compound Name | 2-[[4-[2-[4-[1,1-bis[4-(oxiran-2-ylmethoxy)-3-prop-2-enylphenyl]ethyl]phenyl]propan-2-yl]-2-prop-2-enylphenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 130209636 |
| Molecular Formula | C47H52O6 |
| Molecular Weight | 712.93 g/mol |
| Exact Mass | 712.38 |
| IUPAC Name | 2-[[4-[2-[4-[1,1-bis[4-(oxiran-2-ylmethoxy)-3-prop-2-enylphenyl]ethyl]phenyl]propan-2-yl]-2-prop-2-enylphenoxy]methyl]oxirane |
| SMILES | C=CCc1cc(C(C)(C)c2ccc(C(C)(c3ccc(OCC4CO4)c(CC=C)c3)c3ccc(OCC4CO4)c(CC=C)c3)cc2)ccc1OCC1CO1 |
| InChI | InChI=1S/C47H52O6/c1-7-10-32-23-37(17-20-43(32)51-29-40-26-48-40)46(4,5)35-13-15-36(16-14-35)47(6,38-18-21-44(33(24-38)11-8-2)52-30-41-27-49-41)39-19-22-45(34(25-39)12-9-3)53-31-42-28-50-42/h7-9,13-25,40-42H,1-3,10-12,26-31H2,4-6H3 |
| InChIKey | MKCHWPREYIQARH-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 65.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.93 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|