C25H30O5 — CID 90250195
2-[[2-methyl-4-[2-[4-(oxiran-2-ylmethoxy)-3-(oxiran-2-ylmethyl)phenyl]propan-2-yl]phenoxy]methyl]oxirane (PubChem CID 90250195) has the molecular formula C25H30O5 and a molecular weight of 410.51 g/mol. Its IUPAC name is 2-[[2-methyl-4-[2-[4-(oxiran-2-ylmethoxy)-3-(oxiran-2-ylmethyl)phenyl]propan-2-yl]phenoxy]methyl]oxirane.
| Compound Name | 2-[[2-methyl-4-[2-[4-(oxiran-2-ylmethoxy)-3-(oxiran-2-ylmethyl)phenyl]propan-2-yl]phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 90250195 |
| Molecular Formula | C25H30O5 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 2-[[2-methyl-4-[2-[4-(oxiran-2-ylmethoxy)-3-(oxiran-2-ylmethyl)phenyl]propan-2-yl]phenoxy]methyl]oxirane |
| SMILES | Cc1cc(C(C)(C)c2ccc(OCC3CO3)c(CC3CO3)c2)ccc1OCC1CO1 |
| InChI | InChI=1S/C25H30O5/c1-16-8-18(4-6-23(16)29-14-21-12-27-21)25(2,3)19-5-7-24(30-15-22-13-28-22)17(9-19)10-20-11-26-20/h4-9,20-22H,10-15H2,1-3H3 |
| InChIKey | OXKZIIQRJXYMPT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 56.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|