C35H48O6 — CID 176676139
ethane;2-[[4-[1-[4-(ethoxymethoxy)-3-methylphenyl]-1-[3-methyl-4-(oxiran-2-ylmethoxy)phenyl]ethyl]phenoxy]methyl]oxirane (PubChem CID 176676139) has the molecular formula C35H48O6 and a molecular weight of 564.76 g/mol. Its IUPAC name is ethane;2-[[4-[1-[4-(ethoxymethoxy)-3-methylphenyl]-1-[3-methyl-4-(oxiran-2-ylmethoxy)phenyl]ethyl]phenoxy]methyl]oxirane.
| Compound Name | ethane;2-[[4-[1-[4-(ethoxymethoxy)-3-methylphenyl]-1-[3-methyl-4-(oxiran-2-ylmethoxy)phenyl]ethyl]phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 176676139 |
| Molecular Formula | C35H48O6 |
| Molecular Weight | 564.76 g/mol |
| Exact Mass | 564.35 |
| IUPAC Name | ethane;2-[[4-[1-[4-(ethoxymethoxy)-3-methylphenyl]-1-[3-methyl-4-(oxiran-2-ylmethoxy)phenyl]ethyl]phenoxy]methyl]oxirane |
| SMILES | CC.CC.CCOCOc1ccc(C(C)(c2ccc(OCC3CO3)cc2)c2ccc(OCC3CO3)c(C)c2)cc1C |
| InChI | InChI=1S/C31H36O6.2C2H6/c1-5-32-20-37-30-13-9-25(15-22(30)3)31(4,23-6-10-26(11-7-23)33-16-27-17-34-27)24-8-12-29(21(2)14-24)36-19-28-18-35-28;2*1-2/h6-15,27-28H,5,16-20H2,1-4H3;2*1-2H3 |
| InChIKey | BQAPUUXVDJWZQC-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 61.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.76 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|